![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/odf6odt-20x22.png){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
%20Feed%20LinkedIn.png){kind=link}
%20Feed%20LinkedIn.png){kind=link}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| accepting mistakes/ | 2024-08-05 19:12 | - | |
| achieve/ | 2024-05-21 11:21 | - | |
| action/ | 2024-07-13 02:10 | - | |
| advice/ | 2024-07-21 13:25 | - | |
| age/ | 2024-07-21 13:25 | - | |
| alone/ | 2024-07-21 13:25 | - | |
| anger/ | 2024-07-21 13:25 | - | |
| answer questions/ | 2024-07-21 13:25 | - | |
| anxiety management/ | 2024-07-21 13:25 | - | |
| appearance/ | 2024-07-21 13:25 | - | |
| appreciation/ | 2024-07-21 13:25 | - | |
| attitude/ | 2024-07-21 13:25 | - | |
| automation/ | 2024-07-21 13:25 | - | |
| avoiding idiots/ | 2024-07-21 13:25 | - | |
| banking/ | 2024-07-21 13:25 | - | |
| being with others/ | 2024-07-21 13:25 | - | |
| blaming/ | 2024-07-21 13:25 | - | |
| blessings/ | 2024-07-21 13:25 | - | |
| books/ | 2024-07-21 13:25 | - | |
| business lessons/ | 2024-07-21 13:25 | - | |
| calm/ | 2024-07-21 13:25 | - | |
| challenges/ | 2024-07-21 13:25 | - | |
| changes/ | 2024-07-21 13:25 | - | |
| characteristics/ | 2024-07-21 13:25 | - | |
| children/ | 2024-07-21 13:25 | - | |
| choosing people/ | 2024-07-21 13:25 | - | |
| circles of influence/ | 2024-07-21 13:25 | - | |
| collaboration/ | 2024-07-21 13:25 | - | |
| comfort zone/ | 2024-07-21 13:25 | - | |
| communication/ | 2024-07-21 13:25 | - | |
| completing/ | 2024-07-22 18:31 | - | |
| confidence/ | 2024-07-21 13:25 | - | |
| control/ | 2024-07-21 13:25 | - | |
| countries/ | 2024-07-21 13:25 | - | |
| country_management/ | 2024-07-21 13:25 | - | |
| courage/ | 2024-07-21 13:25 | - | |
| crazy/ | 2024-07-21 13:25 | - | |
| creative people/ | 2024-07-21 13:25 | - | |
| criticism/ | 2024-07-21 13:25 | - | |
| danger field/ | 2024-07-21 13:25 | - | |
| daughter training/ | 2024-07-21 13:25 | - | |
| dealing with negativity/ | 2024-07-21 13:25 | - | |
| dealing with other people/ | 2024-07-21 13:25 | - | |
| delegate/ | 2024-07-21 13:25 | - | |
| depression/ | 2024-07-21 13:25 | - | |
| destiny/ | 2024-07-21 13:25 | - | |
| devil/ | 2024-07-21 13:25 | - | |
| differences/ | 2024-07-21 13:25 | - | |
| direction/ | 2024-07-21 13:25 | - | |
| discipline/ | 2024-07-21 13:25 | - | |
| doing what is required/ | 2024-07-21 13:25 | - | |
| dreams/ | 2024-07-21 13:25 | - | |
| early bird/ | 2024-07-21 17:42 | - | |
| economics/ | 2024-07-21 13:25 | - | |
| economics of life/ | 2024-07-21 13:25 | - | |
| education/ | 2024-07-21 13:25 | - | |
| efforts/ | 2024-09-15 09:02 | - | |
| ego/ | 2024-07-21 13:25 | - | |
| elder games/ | 2024-07-21 13:25 | - | |
| emotions/ | 2024-07-21 13:25 | - | |
| empathy/ | 2024-07-21 13:25 | - | |
| employee management/ | 2024-07-21 13:25 | - | |
| enduring/ | 2024-07-21 13:25 | - | |
| energy/ | 2024-07-21 13:25 | - | |
| enjoying/ | 2024-07-21 13:25 | - | |
| entitelement/ | 2024-07-21 13:25 | - | |
| environment/ | 2024-07-21 13:25 | - | |
| envy/ | 2024-07-21 13:25 | - | |
| everything/ | 2024-07-21 13:25 | - | |
| excuses/ | 2024-07-21 13:25 | - | |
| execution/ | 2024-07-21 13:25 | - | |
| exercise/ | 2024-07-21 13:25 | - | |
| expectations/ | 2024-07-21 13:25 | - | |
| experience/ | 2024-07-21 13:25 | - | |
| failure/ | 2024-07-21 13:25 | - | |
| family/ | 2024-07-21 13:25 | - | |
| fear/ | 2024-07-21 13:25 | - | |
| feelings/ | 2024-07-21 13:25 | - | |
| fighting/ | 2024-07-21 13:25 | - | |
| finances/ | 2024-07-21 13:25 | - | |
| financial management/ | 2024-07-21 13:25 | - | |
| fixing others/ | 2024-07-21 13:25 | - | |
| focus/ | 2024-07-21 13:25 | - | |
| focus slow and steady/ | 2024-07-21 13:25 | - | |
| fooling people/ | 2024-07-21 13:25 | - | |
| for young people/ | 2024-07-21 13:25 | - | |
| friends/ | 2024-07-21 13:25 | - | |
| funny/ | 2024-07-21 13:25 | - | |
| gambling/ | 2024-07-21 13:25 | - | |
| getting things done/ | 2024-07-21 13:25 | - | |
| girls/ | 2024-07-21 13:25 | - | |
| giving it your all/ | 2024-09-03 22:37 | - | |
| goals/ | 2024-07-21 13:25 | - | |
| god/ | 2024-07-21 13:25 | - | |
| going broke/ | 2024-07-21 13:25 | - | |
| good days/ | 2024-07-21 13:25 | - | |
| government/ | 2024-07-21 13:25 | - | |
| greed/ | 2024-07-21 13:25 | - | |
| grit/ | 2024-07-21 13:25 | - | |
| grow/ | 2024-07-21 13:25 | - | |
| habits/ | 2024-07-21 13:25 | - | |
| habits to make/ | 2024-07-21 13:25 | - | |
| happiness/ | 2024-07-21 13:25 | - | |
| hard times/ | 2024-07-21 13:25 | - | |
| health/ | 2024-07-21 13:25 | - | |
| helping others/ | 2024-07-21 13:25 | - | |
| holding on and letting go/ | 2024-07-21 13:25 | - | |
| how old/ | 2024-07-21 13:25 | - | |
| human behavior/ | 2024-07-21 13:25 | - | |
| humanity/ | 2024-07-21 13:25 | - | |
| humble/ | 2024-07-21 13:25 | - | |
| idea management/ | 2024-07-21 13:25 | - | |
| ignorance of the 20 and 21 century/ | 2024-07-21 13:25 | - | |
| ignoring skill/ | 2024-07-21 13:25 | - | |
| impossible/ | 2024-07-21 13:25 | - | |
| improving/ | 2024-07-21 13:25 | - | |
| incivility/ | 2024-07-21 13:25 | - | |
| inertia/ | 2024-07-21 13:25 | - | |
| innovation takes time/ | 2024-07-21 13:25 | - | |
| inspiration/ | 2024-07-21 13:25 | - | |
| integrity/ | 2024-07-21 13:25 | - | |
| intelligence/ | 2024-07-21 13:25 | - | |
| internet/ | 2024-07-21 13:25 | - | |
| introverts/ | 2024-07-21 13:25 | - | |
| investing/ | 2024-07-21 13:25 | - | |
| jealous people/ | 2024-07-21 13:25 | - | |
| job business life balance/ | 2024-07-21 13:25 | - | |
| journal/ | 2024-07-21 13:25 | - | |
| karachi lessons/ | 2024-07-21 13:25 | - | |
| keeping at it/ | 2024-07-21 13:25 | - | |
| kids/ | 2024-07-21 13:25 | - | |
| kids see kids do/ | 2024-07-21 13:25 | - | |
| kind/ | 2024-07-21 13:25 | - | |
| leader/ | 2024-07-21 13:25 | - | |
| leadership/ | 2024-07-21 13:25 | - | |
| learning/ | 2024-07-21 13:25 | - | |
| lessons/ | 2024-07-21 13:25 | - | |
| lessons from aspies/ | 2024-07-21 13:25 | - | |
| letting go of the old/ | 2024-07-21 13:25 | - | |
| letting it go/ | 2024-07-21 13:25 | - | |
| life as a test/ | 2024-07-21 13:25 | - | |
| lifebook presentation 25 mar 2022/ | 2024-07-21 13:25 | - | |
| living/ | 2024-07-21 13:25 | - | |
| lonely/ | 2024-07-21 13:25 | - | |
| long life/ | 2024-07-21 13:25 | - | |
| long term work/ | 2024-07-21 13:25 | - | |
| love/ | 2024-07-21 13:25 | - | |
| management/ | 2024-07-21 13:25 | - | |
| managing resources/ | 2024-07-21 13:25 | - | |
| marriage/ | 2024-07-21 13:25 | - | |
| math/ | 2024-07-21 13:25 | - | |
| meaning of life/ | 2024-07-21 13:25 | - | |
| men women diff/ | 2024-07-21 13:25 | - | |
| millenianls/ | 2024-07-21 13:25 | - | |
| mind/ | 2024-07-21 13:25 | - | |
| mobile addiction/ | 2024-07-21 13:25 | - | |
| mobiles/ | 2024-07-21 13:25 | - | |
| money/ | 2024-07-21 13:25 | - | |
| motivation/ | 2024-07-21 13:25 | - | |
| moving forward/ | 2024-07-21 16:40 | - | |
| negotiation skills/ | 2024-07-24 12:53 | - | |
| older and wiser/ | 2023-10-19 01:38 | - | |
| old people/ | 2024-02-18 14:20 | - | |
| optimism/ | 2023-11-16 21:07 | - | |
| other people/ | 2024-03-20 17:17 | - | |
| out of the box thinking/ | 2024-06-25 12:44 | - | |
| overconfidence/ | 2024-06-29 13:10 | - | |
| overthinking/ | 2024-09-15 09:03 | - | |
| pain/ | 2023-10-19 01:38 | - | |
| pain and suffering/ | 2024-07-21 17:21 | - | |
| parenting/ | 2023-11-04 00:50 | - | |
| past/ | 2023-10-19 01:17 | - | |
| patience/ | 2023-11-05 13:14 | - | |
| peace/ | 2024-06-17 18:15 | - | |
| perspective/ | 2023-12-18 13:17 | - | |
| picking heavy objects/ | 2024-03-18 11:52 | - | |
| places/ | 2024-05-31 10:23 | - | |
| planning/ | 2024-05-20 15:35 | - | |
| positive/ | 2024-06-16 16:54 | - | |
| prayers/ | 2024-07-21 16:52 | - | |
| priorities/ | 2023-11-21 08:42 | - | |
| problems/ | 2023-11-12 16:45 | - | |
| problem solving/ | 2024-05-21 13:40 | - | |
| purpose/ | 2024-03-21 05:41 | - | |
| quality/ | 2023-10-19 01:38 | - | |
| quora answers by kn/ | 2023-10-19 01:38 | - | |
| quotes/ | 2023-10-19 01:37 | - | |
| racism/ | 2023-10-19 01:37 | - | |
| rain/ | 2023-10-19 01:17 | - | |
| reaction/ | 2023-11-01 16:04 | - | |
| reality/ | 2023-12-04 23:28 | - | |
| real kindness/ | 2023-10-19 01:17 | - | |
| reasons for life/ | 2023-10-19 01:37 | - | |
| rebellion/ | 2024-01-06 12:23 | - | |
| refugees/ | 2023-10-19 01:37 | - | |
| rejection dealing/ | 2024-06-29 15:24 | - | |
| relationship/ | 2023-11-01 13:33 | - | |
| respect/ | 2023-11-01 13:32 | - | |
| restarting/ | 2023-10-19 01:37 | - | |
| results/ | 2023-11-05 03:47 | - | |
| risk management/ | 2023-10-19 01:38 | - | |
| rules for life/ | 2024-03-27 12:55 | - | |
| rumi lessons/ | 2024-05-21 13:47 | - | |
| sadness/ | 2024-03-16 07:55 | - | |
| sales/ | 2023-10-19 01:38 | - | |
| scams/ | 2024-06-23 16:53 | - | |
| science/ | 2024-05-21 13:48 | - | |
| seedhay/ | 2023-12-18 13:18 | - | |
| selecting people/ | 2024-04-06 02:26 | - | |
| self awareness/ | 2023-10-19 01:38 | - | |
| self control/ | 2024-05-21 11:16 | - | |
| serious people/ | 2024-09-08 12:12 | - | |
| sharing/ | 2024-01-19 14:22 | - | |
| showing off/ | 2024-06-17 13:48 | - | |
| showing vs being/ | 2024-03-15 15:50 | - | |
| sickness/ | 2023-10-25 19:13 | - | |
| simple/ | 2023-11-27 10:51 | - | |
| simple life/ | 2023-10-19 01:17 | - | |
| skills/ | 2023-10-19 01:37 | - | |
| sleep/ | 2023-10-19 01:37 | - | |
| smart/ | 2023-11-01 13:33 | - | |
| smile/ | 2024-09-05 22:38 | - | |
| social media/ | 2023-10-19 01:38 | - | |
| society/ | 2023-10-19 01:37 | - | |
| speaking/ | 2023-10-19 01:38 | - | |
| splitting bills/ | 2023-10-19 01:37 | - | |
| stamina/ | 2023-10-30 19:43 | - | |
| standardization and procedures/ | 2023-10-19 01:38 | - | |
| starting/ | 2024-03-24 17:54 | - | |
| sticking at it for success/ | 2024-09-08 12:13 | - | |
| strategy vs tactics/ | 2023-10-19 01:37 | - | |
| strength/ | 2023-12-05 15:15 | - | |
| stress management/ | 2023-10-19 01:37 | - | |
| stuck/ | 2024-07-13 21:59 | - | |
| stupid/ | 2023-10-19 01:38 | - | |
| success/ | 2024-07-13 02:06 | - | |
| sukun/ | 2023-10-19 01:38 | - | |
| survival/ | 2023-10-19 01:38 | - | |
| taking action/ | 2023-10-19 01:37 | - | |
| talking/ | 2024-07-13 02:05 | - | |
| tariq aziz/ | 2023-10-19 01:37 | - | |
| teaching/ | 2023-12-29 12:35 | - | |
| technology needs to be pushed/ | 2023-10-19 01:37 | - | |
| thanks/ | 2024-06-30 14:32 | - | |
| theory_of_everything/ | 2024-05-21 13:53 | - | |
| think different/ | 2023-12-18 13:15 | - | |
| thoughts/ | 2024-06-16 04:50 | - | |
| time/ | 2024-09-03 23:01 | - | |
| time management/ | 2024-09-02 21:06 | - | |
| tolerance/ | 2024-04-18 01:14 | - | |
| tough lessons/ | 2023-10-19 01:37 | - | |
| trust/ | 2023-10-19 01:38 | - | |
| trying/ | 2023-10-19 01:38 | - | |
| types of people/ | 2024-09-05 21:33 | - | |
| unity is strength/ | 2023-10-19 01:17 | - | |
| universe creation probability/ | 2023-10-19 01:38 | - | |
| value/ | 2023-11-11 12:39 | - | |
| values/ | 2024-09-03 07:02 | - | |
| what defines you/ | 2023-12-21 13:56 | - | |
| what makes a genius/ | 2024-01-19 14:28 | - | |
| what to focus on/ | 2024-03-06 08:04 | - | |
| what you grow/ | 2024-04-29 11:12 | - | |
| winning/ | 2023-10-19 01:38 | - | |
| working/ | 2024-03-02 15:58 | - | |
| working for/ | 2023-12-11 11:17 | - | |
| worry/ | 2023-10-19 01:38 | - | |
| worth/ | 2023-10-19 01:38 | - | |
| yearning/ | 2023-10-19 01:38 | - | |
| life book by kn 5 nov 2017-1.odt | 2024-07-28 10:20 | 18K | |
| life book by kn 19 sep 2019-1.odt | 2024-07-28 10:20 | 18K | |
| friends.jpeg | 2024-07-28 10:20 | 18K | |
| life_book_7_march_2014-1.odt | 2024-07-28 10:20 | 28K | |
| 55963756_287519742148245_8984586007114416128_n.jpg | 2024-07-28 10:20 | 34K | |
| 1654864577695.jpeg | 2024-07-28 10:20 | 41K | |
| 1654861456941.jpeg | 2024-07-28 10:20 | 43K | |
| IMG-20210410-WA0004.jpg | 2024-07-28 10:20 | 43K | |
| 286260932_10227396056829610_2952922334310210083_n.jpg | 2024-07-28 10:20 | 52K | |
| 1654258131764.jpeg | 2024-07-28 10:20 | 62K | |
| 1654820617592.jpeg | 2024-07-28 10:20 | 63K | |
| 288643827_590962972364660_3207560900550795835_n.jpg | 2024-07-28 10:20 | 71K | |
| 1654862644597.jpeg | 2024-07-28 10:20 | 75K | |
| index.jpeg | 2024-07-28 10:20 | 80K | |
| FVbFEoRWYAI60Bk.jpeg | 2024-07-28 10:20 | 89K | |
| 1654638629624.jpeg | 2024-07-28 10:20 | 90K | |
| 1658131686726.jpeg | 2024-07-28 10:20 | 100K | |
| 1654880159439.jpeg | 2024-07-28 10:20 | 101K | |
| uncommon knowledge 12 nov 2019-1.pdf | 2024-07-28 10:20 | 103K | |
| 1654490857441.jpeg | 2024-07-28 10:20 | 104K | |
| IMG-20161023-WA0012.jpg | 2024-07-28 10:20 | 206K | |
| Screenshot 2022-10-11 at 15-24-59 (8) Feed LinkedIn.png | 2024-07-28 10:20 | 214K | |
| uncommon knowledge 9 nov 2019-1.odt | 2024-07-28 10:20 | 287K | |
| uncommon knowledge 9 nov 2019-2.odt | 2024-07-28 10:20 | 288K | |
| uncommon knowledge 12 nov 2019-1.odt | 2024-07-28 10:20 | 289K | |
| Screenshot 2022-10-11 at 15-25-40 (8) Feed LinkedIn.png | 2024-07-28 10:20 | 315K | |
| rules for life 24 aug 2017-1.odt | 2024-07-28 10:20 | 3.2M | |
| WhatsApp Video 2020-01-06 at 9.34.09 AM.mp4 | 2024-07-28 10:20 | 3.9M | |
| determined_people.mp4 | 2024-07-28 10:20 | 11M | |
| 1673326950337.mp4 | 2024-07-28 10:20 | 37M | |